About CID 87074067
CID 87074067 (PubChem CID 87074067) has the molecular formula C6H8O2Si
and a molecular weight of 140.21 g/mol.
Molecular Properties
| Compound Name | CID 87074067 |
| PubChem CID | 87074067 |
| Molecular Formula | C6H8O2Si |
| Molecular Weight | 140.21 g/mol |
| Exact Mass | 140.03 |
| IUPAC Name | — |
| SMILES | C=CC[Si]OC(=O)C=C |
| InChI | InChI=1S/C6H8O2Si/c1-3-5-9-8-6(7)4-2/h3-4H,1-2,5H2 |
| InChIKey | WRNNKRQBDJIIEL-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.21 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze CID 87074067 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87074067?
The IUPAC name of CID 87074067 (CID 87074067) is not available.
What is the SMILES notation for CID 87074067?
The canonical SMILES for CID 87074067 is C=CC[Si]OC(=O)C=C.
What is the InChIKey of CID 87074067?
The InChIKey is WRNNKRQBDJIIEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O2Si/c1-3-5-9-8-6(7)4-2/h3-4H,1-2,5H2.
What are the key properties of CID 87074067?
CID 87074067 has a molecular weight of 140.21 g/mol, XLogP of 0.94, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87074067 is sourced from PubChem (CID 87074067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).