C26H23N5S2 — CID 87075263
4-[[4-benzyl-6-[(6-methyl-1,3-benzothiazol-2-yl)amino]pyrimidin-2-yl]amino]-3-methylbenzenethiol (PubChem CID 87075263) has the molecular formula C26H23N5S2 and a molecular weight of 469.64 g/mol. Its IUPAC name is 4-[[4-benzyl-6-[(6-methyl-1,3-benzothiazol-2-yl)amino]pyrimidin-2-yl]amino]-3-methylbenzenethiol.
| Compound Name | 4-[[4-benzyl-6-[(6-methyl-1,3-benzothiazol-2-yl)amino]pyrimidin-2-yl]amino]-3-methylbenzenethiol |
|---|---|
| PubChem CID | 87075263 |
| Molecular Formula | C26H23N5S2 |
| Molecular Weight | 469.64 g/mol |
| Exact Mass | 469.14 |
| IUPAC Name | 4-[[4-benzyl-6-[(6-methyl-1,3-benzothiazol-2-yl)amino]pyrimidin-2-yl]amino]-3-methylbenzenethiol |
| SMILES | Cc1ccc2nc(Nc3cc(Cc4ccccc4)nc(Nc4ccc(S)cc4C)n3)sc2c1 |
| InChI | InChI=1S/C26H23N5S2/c1-16-8-10-22-23(12-16)33-26(29-22)31-24-15-19(14-18-6-4-3-5-7-18)27-25(30-24)28-21-11-9-20(32)13-17(21)2/h3-13,15,32H,14H2,1-2H3,(H2,27,28,29,30,31) |
| InChIKey | KFPUIUUOAMFQQH-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.64 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|