C18H12BrFN4S — CID 87070718
N-(6-benzyl-2-fluoropyrimidin-4-yl)-6-bromo-1,3-benzothiazol-2-amine (PubChem CID 87070718) has the molecular formula C18H12BrFN4S and a molecular weight of 415.29 g/mol. Its IUPAC name is N-(6-benzyl-2-fluoropyrimidin-4-yl)-6-bromo-1,3-benzothiazol-2-amine.
| Compound Name | N-(6-benzyl-2-fluoropyrimidin-4-yl)-6-bromo-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 87070718 |
| Molecular Formula | C18H12BrFN4S |
| Molecular Weight | 415.29 g/mol |
| Exact Mass | 414.00 |
| IUPAC Name | N-(6-benzyl-2-fluoropyrimidin-4-yl)-6-bromo-1,3-benzothiazol-2-amine |
| SMILES | Fc1nc(Cc2ccccc2)cc(Nc2nc3ccc(Br)cc3s2)n1 |
| InChI | InChI=1S/C18H12BrFN4S/c19-12-6-7-14-15(9-12)25-18(22-14)24-16-10-13(21-17(20)23-16)8-11-4-2-1-3-5-11/h1-7,9-10H,8H2,(H,21,22,23,24) |
| InChIKey | ZGKAUGVUSNFDKH-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.29 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |