C23H42O5 — CID 87076190
15-butan-2-yloxy-4,4,14,14-tetramethyl-8,15-dioxopentadecanoic acid (PubChem CID 87076190) has the molecular formula C23H42O5 and a molecular weight of 398.58 g/mol. Its IUPAC name is 15-butan-2-yloxy-4,4,14,14-tetramethyl-8,15-dioxopentadecanoic acid.
| Compound Name | 15-butan-2-yloxy-4,4,14,14-tetramethyl-8,15-dioxopentadecanoic acid |
|---|---|
| PubChem CID | 87076190 |
| Molecular Formula | C23H42O5 |
| Molecular Weight | 398.58 g/mol |
| Exact Mass | 398.30 |
| IUPAC Name | 15-butan-2-yloxy-4,4,14,14-tetramethyl-8,15-dioxopentadecanoic acid |
| SMILES | CCC(C)OC(=O)C(C)(C)CCCCCC(=O)CCCC(C)(C)CCC(=O)O |
| InChI | InChI=1S/C23H42O5/c1-7-18(2)28-21(27)23(5,6)16-10-8-9-12-19(24)13-11-15-22(3,4)17-14-20(25)26/h18H,7-17H2,1-6H3,(H,25,26) |
| InChIKey | JVDQYTGVXUUGMS-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.58 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|