C8H12ClNO — CID 87078087
(1R,4S)-2-methyl-2-azabicyclo[2.2.1]heptane-1-carbonyl chloride (PubChem CID 87078087) has the molecular formula C8H12ClNO and a molecular weight of 173.64 g/mol. Its IUPAC name is (1R,4S)-2-methyl-2-azabicyclo[2.2.1]heptane-1-carbonyl chloride.
| Compound Name | (1R,4S)-2-methyl-2-azabicyclo[2.2.1]heptane-1-carbonyl chloride |
|---|---|
| PubChem CID | 87078087 |
| Molecular Formula | C8H12ClNO |
| Molecular Weight | 173.64 g/mol |
| Exact Mass | 173.06 |
| IUPAC Name | (1R,4S)-2-methyl-2-azabicyclo[2.2.1]heptane-1-carbonyl chloride |
| SMILES | CN1C[C@H]2CC[C@]1(C(=O)Cl)C2 |
| InChI | InChI=1S/C8H12ClNO/c1-10-5-6-2-3-8(10,4-6)7(9)11/h6H,2-5H2,1H3/t6-,8+/m0/s1 |
| InChIKey | LMNQZHJSAMGJRU-POYBYMJQSA-N |
| XLogP | 1.24 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.64 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|