About (1S,8R)-N-methyltricyclo[4.3.1.13,8]undecane-3-carboxamide
(1S,8R)-N-methyltricyclo[4.3.1.13,8]undecane-3-carboxamide (PubChem CID 6939296) has the molecular formula C13H21NO
and a molecular weight of 207.32 g/mol. Its IUPAC name is (1S,8R)-N-methyltricyclo[4.3.1.13,8]undecane-3-carboxamide.
Molecular Properties
| Compound Name | (1S,8R)-N-methyltricyclo[4.3.1.13,8]undecane-3-carboxamide |
| PubChem CID | 6939296 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | (1S,8R)-N-methyltricyclo[4.3.1.13,8]undecane-3-carboxamide |
| SMILES | CNC(=O)C12CCC3C[C@H](C[C@H](C3)C1)C2 |
| InChI | InChI=1S/C13H21NO/c1-14-12(15)13-3-2-9-4-10(7-13)6-11(5-9)8-13/h9-11H,2-8H2,1H3,(H,14,15)/t9?,10-,11+,13? |
| InChIKey | ZTXZYLSLWKJSFU-VOZVASTJSA-N |
| XLogP | 2.34 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1S,8R)-N-methyltricyclo[4.3.1.13,8]undecane-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,8R)-N-methyltricyclo[4.3.1.13,8]undecane-3-carboxamide?
The IUPAC name of (1S,8R)-N-methyltricyclo[4.3.1.13,8]undecane-3-carboxamide (CID 6939296) is (1S,8R)-N-methyltricyclo[4.3.1.13,8]undecane-3-carboxamide.
What is the SMILES notation for (1S,8R)-N-methyltricyclo[4.3.1.13,8]undecane-3-carboxamide?
The canonical SMILES for (1S,8R)-N-methyltricyclo[4.3.1.13,8]undecane-3-carboxamide is CNC(=O)C12CCC3C[C@H](C[C@H](C3)C1)C2.
What is the InChIKey of (1S,8R)-N-methyltricyclo[4.3.1.13,8]undecane-3-carboxamide?
The InChIKey is ZTXZYLSLWKJSFU-VOZVASTJSA-N. The full InChI is InChI=1S/C13H21NO/c1-14-12(15)13-3-2-9-4-10(7-13)6-11(5-9)8-13/h9-11H,2-8H2,1H3,(H,14,15)/t9?,10-,11+,13?.
What are the key properties of (1S,8R)-N-methyltricyclo[4.3.1.13,8]undecane-3-carboxamide?
(1S,8R)-N-methyltricyclo[4.3.1.13,8]undecane-3-carboxamide has a molecular weight of 207.32 g/mol, XLogP of 2.34, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,8R)-N-methyltricyclo[4.3.1.13,8]undecane-3-carboxamide is sourced from PubChem (CID 6939296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).