C24H29ClN4O3S — CID 87078951
N-[(2S)-2-[acetyl-[(2-chlorophenyl)methylamino]amino]-4-methylpentoxy]-N-(6-methyl-1,3-benzothiazol-2-yl)formamide (PubChem CID 87078951) has the molecular formula C24H29ClN4O3S and a molecular weight of 489.04 g/mol. Its IUPAC name is N-[(2S)-2-[acetyl-[(2-chlorophenyl)methylamino]amino]-4-methylpentoxy]-N-(6-methyl-1,3-benzothiazol-2-yl)formamide.
| Compound Name | N-[(2S)-2-[acetyl-[(2-chlorophenyl)methylamino]amino]-4-methylpentoxy]-N-(6-methyl-1,3-benzothiazol-2-yl)formamide |
|---|---|
| PubChem CID | 87078951 |
| Molecular Formula | C24H29ClN4O3S |
| Molecular Weight | 489.04 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | N-[(2S)-2-[acetyl-[(2-chlorophenyl)methylamino]amino]-4-methylpentoxy]-N-(6-methyl-1,3-benzothiazol-2-yl)formamide |
| SMILES | CC(=O)N(NCc1ccccc1Cl)[C@H](CON(C=O)c1nc2ccc(C)cc2s1)CC(C)C |
| InChI | InChI=1S/C24H29ClN4O3S/c1-16(2)11-20(29(18(4)31)26-13-19-7-5-6-8-21(19)25)14-32-28(15-30)24-27-22-10-9-17(3)12-23(22)33-24/h5-10,12,15-16,20,26H,11,13-14H2,1-4H3/t20-/m0/s1 |
| InChIKey | BXVNAXGZZJDCFI-FQEVSTJZSA-N |
| XLogP | 5.12 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.04 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|