C19H19ClN4O3S — CID 87653952
2-[acetyl-[(2-chlorophenyl)methylamino]amino]ethyl N-(1,3-benzothiazol-2-yl)carbamate (PubChem CID 87653952) has the molecular formula C19H19ClN4O3S and a molecular weight of 418.91 g/mol. Its IUPAC name is 2-[acetyl-[(2-chlorophenyl)methylamino]amino]ethyl N-(1,3-benzothiazol-2-yl)carbamate.
| Compound Name | 2-[acetyl-[(2-chlorophenyl)methylamino]amino]ethyl N-(1,3-benzothiazol-2-yl)carbamate |
|---|---|
| PubChem CID | 87653952 |
| Molecular Formula | C19H19ClN4O3S |
| Molecular Weight | 418.91 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | 2-[acetyl-[(2-chlorophenyl)methylamino]amino]ethyl N-(1,3-benzothiazol-2-yl)carbamate |
| SMILES | CC(=O)N(CCOC(=O)Nc1nc2ccccc2s1)NCc1ccccc1Cl |
| InChI | InChI=1S/C19H19ClN4O3S/c1-13(25)24(21-12-14-6-2-3-7-15(14)20)10-11-27-19(26)23-18-22-16-8-4-5-9-17(16)28-18/h2-9,21H,10-12H2,1H3,(H,22,23,26) |
| InChIKey | BIIXPIZRUTZUJH-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.91 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|