About octane;oxo-bis[[tributyl(methyl)-λ5-phosphanyl]oxy]phosphanium
octane;oxo-bis[[tributyl(methyl)-λ5-phosphanyl]oxy]phosphanium (PubChem CID 87081062) has the molecular formula C34H78O3P3+
and a molecular weight of 627.92 g/mol. Its IUPAC name is octane;oxo-bis[[tributyl(methyl)-λ5-phosphanyl]oxy]phosphanium.
Molecular Properties
| Compound Name | octane;oxo-bis[[tributyl(methyl)-λ5-phosphanyl]oxy]phosphanium |
| PubChem CID | 87081062 |
| Molecular Formula | C34H78O3P3+ |
| Molecular Weight | 627.92 g/mol |
| Exact Mass | 627.52 |
| IUPAC Name | octane;oxo-bis[[tributyl(methyl)-λ5-phosphanyl]oxy]phosphanium |
| SMILES | CCCCCCCC.CCCCP(C)(CCCC)(CCCC)O[P+](=O)OP(C)(CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C26H60O3P3.C8H18/c1-9-15-21-31(7,22-16-10-2,23-17-11-3)28-30(27)29-32(8,24-18-12-4,25-19-13-5)26-20-14-6;1-3-5-7-8-6-4-2/h9-26H2,1-8H3;3-8H2,1-2H3/q+1; |
| InChIKey | NLXFXIBJAOFZGO-UHFFFAOYSA-N |
| XLogP | 14.04 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 627.92 |
| LogP ≤ 5 | 14.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze octane;oxo-bis[[tributyl(methyl)-λ5-phosphanyl]oxy]phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octane;oxo-bis[[tributyl(methyl)-λ5-phosphanyl]oxy]phosphanium?
The IUPAC name of octane;oxo-bis[[tributyl(methyl)-λ5-phosphanyl]oxy]phosphanium (CID 87081062) is octane;oxo-bis[[tributyl(methyl)-λ5-phosphanyl]oxy]phosphanium.
What is the SMILES notation for octane;oxo-bis[[tributyl(methyl)-λ5-phosphanyl]oxy]phosphanium?
The canonical SMILES for octane;oxo-bis[[tributyl(methyl)-λ5-phosphanyl]oxy]phosphanium is CCCCCCCC.CCCCP(C)(CCCC)(CCCC)O[P+](=O)OP(C)(CCCC)(CCCC)CCCC.
What is the InChIKey of octane;oxo-bis[[tributyl(methyl)-λ5-phosphanyl]oxy]phosphanium?
The InChIKey is NLXFXIBJAOFZGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H60O3P3.C8H18/c1-9-15-21-31(7,22-16-10-2,23-17-11-3)28-30(27)29-32(8,24-18-12-4,25-19-13-5)26-20-14-6;1-3-5-7-8-6-4-2/h9-26H2,1-8H3;3-8H2,1-2H3/q+1;.
What are the key properties of octane;oxo-bis[[tributyl(methyl)-λ5-phosphanyl]oxy]phosphanium?
octane;oxo-bis[[tributyl(methyl)-λ5-phosphanyl]oxy]phosphanium has a molecular weight of 627.92 g/mol, XLogP of 14.04, 27 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for octane;oxo-bis[[tributyl(methyl)-λ5-phosphanyl]oxy]phosphanium is sourced from PubChem (CID 87081062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).