About [methyl(trioctyl)-λ5-phosphanyl] acetate
[methyl(trioctyl)-λ5-phosphanyl] acetate (PubChem CID 87134097) has the molecular formula C27H57O2P
and a molecular weight of 444.73 g/mol. Its IUPAC name is [methyl(trioctyl)-λ5-phosphanyl] acetate.
Molecular Properties
| Compound Name | [methyl(trioctyl)-λ5-phosphanyl] acetate |
| PubChem CID | 87134097 |
| Molecular Formula | C27H57O2P |
| Molecular Weight | 444.73 g/mol |
| Exact Mass | 444.41 |
| IUPAC Name | [methyl(trioctyl)-λ5-phosphanyl] acetate |
| SMILES | CCCCCCCCP(C)(CCCCCCCC)(CCCCCCCC)OC(C)=O |
| InChI | InChI=1S/C27H57O2P/c1-6-9-12-15-18-21-24-30(5,29-27(4)28,25-22-19-16-13-10-7-2)26-23-20-17-14-11-8-3/h6-26H2,1-5H3 |
| InChIKey | DCDKLORMPLXQKU-UHFFFAOYSA-N |
| XLogP | 9.73 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 444.73 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [methyl(trioctyl)-λ5-phosphanyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [methyl(trioctyl)-λ5-phosphanyl] acetate?
The IUPAC name of [methyl(trioctyl)-λ5-phosphanyl] acetate (CID 87134097) is [methyl(trioctyl)-λ5-phosphanyl] acetate.
What is the SMILES notation for [methyl(trioctyl)-λ5-phosphanyl] acetate?
The canonical SMILES for [methyl(trioctyl)-λ5-phosphanyl] acetate is CCCCCCCCP(C)(CCCCCCCC)(CCCCCCCC)OC(C)=O.
What is the InChIKey of [methyl(trioctyl)-λ5-phosphanyl] acetate?
The InChIKey is DCDKLORMPLXQKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H57O2P/c1-6-9-12-15-18-21-24-30(5,29-27(4)28,25-22-19-16-13-10-7-2)26-23-20-17-14-11-8-3/h6-26H2,1-5H3.
What are the key properties of [methyl(trioctyl)-λ5-phosphanyl] acetate?
[methyl(trioctyl)-λ5-phosphanyl] acetate has a molecular weight of 444.73 g/mol, XLogP of 9.73, 22 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [methyl(trioctyl)-λ5-phosphanyl] acetate is sourced from PubChem (CID 87134097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).