C33H24Cl2F7N5O4 — CID 87082502
1-[4-[(2R,5R)-2,5-bis(4-chloro-2-fluoro-5-nitrophenyl)pyrrolidin-1-yl]-2,6-difluorophenyl]-4-[4-(trifluoromethyl)phenyl]piperazine (PubChem CID 87082502) has the molecular formula C33H24Cl2F7N5O4 and a molecular weight of 758.48 g/mol. Its IUPAC name is 1-[4-[(2R,5R)-2,5-bis(4-chloro-2-fluoro-5-nitrophenyl)pyrrolidin-1-yl]-2,6-difluorophenyl]-4-[4-(trifluoromethyl)phenyl]piperazine.
| Compound Name | 1-[4-[(2R,5R)-2,5-bis(4-chloro-2-fluoro-5-nitrophenyl)pyrrolidin-1-yl]-2,6-difluorophenyl]-4-[4-(trifluoromethyl)phenyl]piperazine |
|---|---|
| PubChem CID | 87082502 |
| Molecular Formula | C33H24Cl2F7N5O4 |
| Molecular Weight | 758.48 g/mol |
| Exact Mass | 757.11 |
| IUPAC Name | 1-[4-[(2R,5R)-2,5-bis(4-chloro-2-fluoro-5-nitrophenyl)pyrrolidin-1-yl]-2,6-difluorophenyl]-4-[4-(trifluoromethyl)phenyl]piperazine |
| SMILES | O=[N+]([O-])c1cc([C@H]2CC[C@H](c3cc([N+](=O)[O-])c(Cl)cc3F)N2c2cc(F)c(N3CCN(c4ccc(C(F)(F)F)cc4)CC3)c(F)c2)c(F)cc1Cl |
| InChI | InChI=1S/C33H24Cl2F7N5O4/c34-22-15-24(36)20(13-30(22)46(48)49)28-5-6-29(21-14-31(47(50)51)23(35)16-25(21)37)45(28)19-11-26(38)32(27(39)12-19)44-9-7-43(8-10-44)18-3-1-17(2-4-18)33(40,41)42/h1-4,11-16,28-29H,5-10H2/t28-,29-/m1/s1 |
| InChIKey | HRVZZZTVDFMSOK-FQLXRVMXSA-N |
| XLogP | 9.79 |
| TPSA | 96.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.48 |
| LogP ≤ 5 | 9.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|