C15H19ClN4O2S — CID 87082767
1-(3-chlorophenyl)-5-methyl-1,2,4-triazole;1-(2-sulfonylethyl)pyrrolidine (PubChem CID 87082767) has the molecular formula C15H19ClN4O2S and a molecular weight of 354.86 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-5-methyl-1,2,4-triazole;1-(2-sulfonylethyl)pyrrolidine.
| Compound Name | 1-(3-chlorophenyl)-5-methyl-1,2,4-triazole;1-(2-sulfonylethyl)pyrrolidine |
|---|---|
| PubChem CID | 87082767 |
| Molecular Formula | C15H19ClN4O2S |
| Molecular Weight | 354.86 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | 1-(3-chlorophenyl)-5-methyl-1,2,4-triazole;1-(2-sulfonylethyl)pyrrolidine |
| SMILES | Cc1ncnn1-c1cccc(Cl)c1.O=S(=O)=CCN1CCCC1 |
| InChI | InChI=1S/C9H8ClN3.C6H11NO2S/c1-7-11-6-12-13(7)9-4-2-3-8(10)5-9;8-10(9)6-5-7-3-1-2-4-7/h2-6H,1H3;6H,1-5H2 |
| InChIKey | IJUNNJQYWKEXCF-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.86 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|