C9H6ClN3O — CID 174648512
2-(3-chlorophenyl)-1,2,4-triazole-3-carbaldehyde (PubChem CID 174648512) has the molecular formula C9H6ClN3O and a molecular weight of 207.62 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-1,2,4-triazole-3-carbaldehyde.
| Compound Name | 2-(3-chlorophenyl)-1,2,4-triazole-3-carbaldehyde |
|---|---|
| PubChem CID | 174648512 |
| Molecular Formula | C9H6ClN3O |
| Molecular Weight | 207.62 g/mol |
| Exact Mass | 207.02 |
| IUPAC Name | 2-(3-chlorophenyl)-1,2,4-triazole-3-carbaldehyde |
| SMILES | O=Cc1ncnn1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C9H6ClN3O/c10-7-2-1-3-8(4-7)13-9(5-14)11-6-12-13/h1-6H |
| InChIKey | RXHGWWGXYHBXRA-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.62 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|