C9H5ClN4 — CID 84672777
2-(3-chlorophenyl)-1,2,4-triazole-3-carbonitrile (PubChem CID 84672777) has the molecular formula C9H5ClN4 and a molecular weight of 204.62 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-1,2,4-triazole-3-carbonitrile.
| Compound Name | 2-(3-chlorophenyl)-1,2,4-triazole-3-carbonitrile |
|---|---|
| PubChem CID | 84672777 |
| Molecular Formula | C9H5ClN4 |
| Molecular Weight | 204.62 g/mol |
| Exact Mass | 204.02 |
| IUPAC Name | 2-(3-chlorophenyl)-1,2,4-triazole-3-carbonitrile |
| SMILES | N#Cc1ncnn1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C9H5ClN4/c10-7-2-1-3-8(4-7)14-9(5-11)12-6-13-14/h1-4,6H |
| InChIKey | KKMWGWXOSPFJOY-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.62 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |