C31H32N2O5S — CID 87085624
3-amino-4-[3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]furan-2-carbothioamide (PubChem CID 87085624) has the molecular formula C31H32N2O5S and a molecular weight of 544.67 g/mol. Its IUPAC name is 3-amino-4-[3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]furan-2-carbothioamide.
| Compound Name | 3-amino-4-[3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]furan-2-carbothioamide |
|---|---|
| PubChem CID | 87085624 |
| Molecular Formula | C31H32N2O5S |
| Molecular Weight | 544.67 g/mol |
| Exact Mass | 544.20 |
| IUPAC Name | 3-amino-4-[3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]furan-2-carbothioamide |
| SMILES | NC(=S)c1occ(C2OC(COCc3ccccc3)C(OCc3ccccc3)C2OCc2ccccc2)c1N |
| InChI | InChI=1S/C31H32N2O5S/c32-26-24(19-37-29(26)31(33)39)27-30(36-18-23-14-8-3-9-15-23)28(35-17-22-12-6-2-7-13-22)25(38-27)20-34-16-21-10-4-1-5-11-21/h1-15,19,25,27-28,30H,16-18,20,32H2,(H2,33,39) |
| InChIKey | KWZPQRHJZXQVPP-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 102.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.67 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|