C22H25N5O2 — CID 87086500
3-[(5R,7R)-17-cyano-14-methyl-2,14-diazatetracyclo[13.4.0.02,7.08,13]nonadeca-1(15),8,10,12,16,18-hexaen-5-yl]-1-methoxy-1-methylurea (PubChem CID 87086500) has the molecular formula C22H25N5O2 and a molecular weight of 391.48 g/mol. Its IUPAC name is 3-[(5R,7R)-17-cyano-14-methyl-2,14-diazatetracyclo[13.4.0.02,7.08,13]nonadeca-1(15),8,10,12,16,18-hexaen-5-yl]-1-methoxy-1-methylurea.
| Compound Name | 3-[(5R,7R)-17-cyano-14-methyl-2,14-diazatetracyclo[13.4.0.02,7.08,13]nonadeca-1(15),8,10,12,16,18-hexaen-5-yl]-1-methoxy-1-methylurea |
|---|---|
| PubChem CID | 87086500 |
| Molecular Formula | C22H25N5O2 |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | 3-[(5R,7R)-17-cyano-14-methyl-2,14-diazatetracyclo[13.4.0.02,7.08,13]nonadeca-1(15),8,10,12,16,18-hexaen-5-yl]-1-methoxy-1-methylurea |
| SMILES | CON(C)C(=O)N[C@@H]1CCN2c3ccc(C#N)cc3N(C)c3ccccc3[C@H]2C1 |
| InChI | InChI=1S/C22H25N5O2/c1-25-18-7-5-4-6-17(18)20-13-16(24-22(28)26(2)29-3)10-11-27(20)19-9-8-15(14-23)12-21(19)25/h4-9,12,16,20H,10-11,13H2,1-3H3,(H,24,28)/t16-,20-/m1/s1 |
| InChIKey | BUNVTSVZSCDTND-OXQOHEQNSA-N |
| XLogP | 3.55 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|