C22H28N6O2S — CID 143419830
(5R,7R,14R)-5-[bis(methylamino)sulfamoylamino]-17-cyano-14-methyl-2-azatetracyclo[13.4.0.02,7.08,13]nonadeca-1(15),8,10,12,16,18-hexaene (PubChem CID 143419830) has the molecular formula C22H28N6O2S and a molecular weight of 440.57 g/mol. Its IUPAC name is (5R,7R,14R)-5-[bis(methylamino)sulfamoylamino]-17-cyano-14-methyl-2-azatetracyclo[13.4.0.02,7.08,13]nonadeca-1(15),8,10,12,16,18-hexaene.
| Compound Name | (5R,7R,14R)-5-[bis(methylamino)sulfamoylamino]-17-cyano-14-methyl-2-azatetracyclo[13.4.0.02,7.08,13]nonadeca-1(15),8,10,12,16,18-hexaene |
|---|---|
| PubChem CID | 143419830 |
| Molecular Formula | C22H28N6O2S |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | (5R,7R,14R)-5-[bis(methylamino)sulfamoylamino]-17-cyano-14-methyl-2-azatetracyclo[13.4.0.02,7.08,13]nonadeca-1(15),8,10,12,16,18-hexaene |
| SMILES | CNN(NC)S(=O)(=O)N[C@@H]1CCN2c3ccc(C#N)cc3[C@H](C)c3ccccc3[C@H]2C1 |
| InChI | InChI=1S/C22H28N6O2S/c1-15-18-6-4-5-7-19(18)22-13-17(26-31(29,30)28(24-2)25-3)10-11-27(22)21-9-8-16(14-23)12-20(15)21/h4-9,12,15,17,22,24-26H,10-11,13H2,1-3H3/t15-,17-,22-/m1/s1 |
| InChIKey | HXRUJGTXOJWLRB-ZDPZECHZSA-N |
| XLogP | 2.14 |
| TPSA | 100.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|