C25H25N5O — CID 178045270
(7S,14S)-5-[(6-methoxypyridazin-3-yl)amino]-14-methyl-2-azatetracyclo[13.4.0.02,7.08,13]nonadeca-1(15),8,10,12,16,18-hexaene-17-carbonitrile (PubChem CID 178045270) has the molecular formula C25H25N5O and a molecular weight of 411.51 g/mol. Its IUPAC name is (7S,14S)-5-[(6-methoxypyridazin-3-yl)amino]-14-methyl-2-azatetracyclo[13.4.0.02,7.08,13]nonadeca-1(15),8,10,12,16,18-hexaene-17-carbonitrile.
| Compound Name | (7S,14S)-5-[(6-methoxypyridazin-3-yl)amino]-14-methyl-2-azatetracyclo[13.4.0.02,7.08,13]nonadeca-1(15),8,10,12,16,18-hexaene-17-carbonitrile |
|---|---|
| PubChem CID | 178045270 |
| Molecular Formula | C25H25N5O |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | (7S,14S)-5-[(6-methoxypyridazin-3-yl)amino]-14-methyl-2-azatetracyclo[13.4.0.02,7.08,13]nonadeca-1(15),8,10,12,16,18-hexaene-17-carbonitrile |
| SMILES | COc1ccc(NC2CCN3c4ccc(C#N)cc4[C@@H](C)c4ccccc4[C@@H]3C2)nn1 |
| InChI | InChI=1S/C25H25N5O/c1-16-19-5-3-4-6-20(19)23-14-18(27-24-9-10-25(31-2)29-28-24)11-12-30(23)22-8-7-17(15-26)13-21(16)22/h3-10,13,16,18,23H,11-12,14H2,1-2H3,(H,27,28)/t16-,18?,23-/m0/s1 |
| InChIKey | SUGABEKAHDOYNT-RAEDPMGTSA-N |
| XLogP | 4.64 |
| TPSA | 74.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |