C21H22ClN5O — CID 87091481
2-(2-chlorophenyl)-2-[5-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-5,8-diazaspiro[2.6]nonan-8-yl]acetaldehyde (PubChem CID 87091481) has the molecular formula C21H22ClN5O and a molecular weight of 395.89 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-2-[5-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-5,8-diazaspiro[2.6]nonan-8-yl]acetaldehyde.
| Compound Name | 2-(2-chlorophenyl)-2-[5-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-5,8-diazaspiro[2.6]nonan-8-yl]acetaldehyde |
|---|---|
| PubChem CID | 87091481 |
| Molecular Formula | C21H22ClN5O |
| Molecular Weight | 395.89 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 2-(2-chlorophenyl)-2-[5-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-5,8-diazaspiro[2.6]nonan-8-yl]acetaldehyde |
| SMILES | O=CC(c1ccccc1Cl)N1CCN(c2ncnc3[nH]ccc23)CC2(CC2)C1 |
| InChI | InChI=1S/C21H22ClN5O/c22-17-4-2-1-3-15(17)18(11-28)26-9-10-27(13-21(12-26)6-7-21)20-16-5-8-23-19(16)24-14-25-20/h1-5,8,11,14,18H,6-7,9-10,12-13H2,(H,23,24,25) |
| InChIKey | KMBAZFDWIBOHNJ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.89 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|