C25H31N5O — CID 87091530
2-(4-tert-butylphenyl)-2-[5-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-5,8-diazaspiro[2.6]nonan-8-yl]acetaldehyde (PubChem CID 87091530) has the molecular formula C25H31N5O and a molecular weight of 417.56 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-2-[5-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-5,8-diazaspiro[2.6]nonan-8-yl]acetaldehyde.
| Compound Name | 2-(4-tert-butylphenyl)-2-[5-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-5,8-diazaspiro[2.6]nonan-8-yl]acetaldehyde |
|---|---|
| PubChem CID | 87091530 |
| Molecular Formula | C25H31N5O |
| Molecular Weight | 417.56 g/mol |
| Exact Mass | 417.25 |
| IUPAC Name | 2-(4-tert-butylphenyl)-2-[5-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-5,8-diazaspiro[2.6]nonan-8-yl]acetaldehyde |
| SMILES | CC(C)(C)c1ccc(C(C=O)N2CCN(c3ncnc4[nH]ccc34)CC3(CC3)C2)cc1 |
| InChI | InChI=1S/C25H31N5O/c1-24(2,3)19-6-4-18(5-7-19)21(14-31)29-12-13-30(16-25(15-29)9-10-25)23-20-8-11-26-22(20)27-17-28-23/h4-8,11,14,17,21H,9-10,12-13,15-16H2,1-3H3,(H,26,27,28) |
| InChIKey | ZMEXDAKPAJGWDN-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.56 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|