C16H21N5O3S — CID 87192192
3-methylsulfonyl-3-[7-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-4,7-diazaspiro[2.5]octan-4-yl]propanal (PubChem CID 87192192) has the molecular formula C16H21N5O3S and a molecular weight of 363.44 g/mol. Its IUPAC name is 3-methylsulfonyl-3-[7-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-4,7-diazaspiro[2.5]octan-4-yl]propanal.
| Compound Name | 3-methylsulfonyl-3-[7-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-4,7-diazaspiro[2.5]octan-4-yl]propanal |
|---|---|
| PubChem CID | 87192192 |
| Molecular Formula | C16H21N5O3S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | 3-methylsulfonyl-3-[7-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-4,7-diazaspiro[2.5]octan-4-yl]propanal |
| SMILES | CS(=O)(=O)C(CC=O)N1CCN(c2ncnc3[nH]ccc23)CC12CC2 |
| InChI | InChI=1S/C16H21N5O3S/c1-25(23,24)13(3-9-22)21-8-7-20(10-16(21)4-5-16)15-12-2-6-17-14(12)18-11-19-15/h2,6,9,11,13H,3-5,7-8,10H2,1H3,(H,17,18,19) |
| InChIKey | KGAARJCUVLBRRB-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|