C16H10N2O3 — CID 87092127
(4-nitroso-5-phenyl-1,2-oxazol-3-yl)-phenylmethanone (PubChem CID 87092127) has the molecular formula C16H10N2O3 and a molecular weight of 278.27 g/mol. Its IUPAC name is (4-nitroso-5-phenyl-1,2-oxazol-3-yl)-phenylmethanone.
| Compound Name | (4-nitroso-5-phenyl-1,2-oxazol-3-yl)-phenylmethanone |
|---|---|
| PubChem CID | 87092127 |
| Molecular Formula | C16H10N2O3 |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | (4-nitroso-5-phenyl-1,2-oxazol-3-yl)-phenylmethanone |
| SMILES | O=Nc1c(C(=O)c2ccccc2)noc1-c1ccccc1 |
| InChI | InChI=1S/C16H10N2O3/c19-15(11-7-3-1-4-8-11)13-14(17-20)16(21-18-13)12-9-5-2-6-10-12/h1-10H |
| InChIKey | HFYPALWIJYXQFK-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 72.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |