C6H12N2O2S — CID 87096037
(2S,3S)-2-amino-3-[(Z)-2-aminoethenyl]sulfanylbutanoic acid (PubChem CID 87096037) has the molecular formula C6H12N2O2S and a molecular weight of 176.24 g/mol. Its IUPAC name is (2S,3S)-2-amino-3-[(Z)-2-aminoethenyl]sulfanylbutanoic acid.
| Compound Name | (2S,3S)-2-amino-3-[(Z)-2-aminoethenyl]sulfanylbutanoic acid |
|---|---|
| PubChem CID | 87096037 |
| Molecular Formula | C6H12N2O2S |
| Molecular Weight | 176.24 g/mol |
| Exact Mass | 176.06 |
| IUPAC Name | (2S,3S)-2-amino-3-[(Z)-2-aminoethenyl]sulfanylbutanoic acid |
| SMILES | C[C@H](S/C=C\N)[C@@H](N)C(=O)O |
| InChI | InChI=1S/C6H12N2O2S/c1-4(11-3-2-7)5(8)6(9)10/h2-5H,7-8H2,1H3,(H,9,10)/b3-2-/t4-,5+/m0/s1 |
| InChIKey | KOERMNWVOQFBST-IBURBRGDSA-N |
| XLogP | -0.05 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.24 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |