About 2-octyloxiran-2-amine
2-octyloxiran-2-amine (PubChem CID 87096100) has the molecular formula C10H21NO
and a molecular weight of 171.28 g/mol. Its IUPAC name is 2-octyloxiran-2-amine.
Molecular Properties
| Compound Name | 2-octyloxiran-2-amine |
| PubChem CID | 87096100 |
| Molecular Formula | C10H21NO |
| Molecular Weight | 171.28 g/mol |
| Exact Mass | 171.16 |
| IUPAC Name | 2-octyloxiran-2-amine |
| SMILES | CCCCCCCCC1(N)CO1 |
| InChI | InChI=1S/C10H21NO/c1-2-3-4-5-6-7-8-10(11)9-12-10/h2-9,11H2,1H3 |
| InChIKey | GBOIKRZSODTIRO-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 38.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.28 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-octyloxiran-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-octyloxiran-2-amine?
The IUPAC name of 2-octyloxiran-2-amine (CID 87096100) is 2-octyloxiran-2-amine.
What is the SMILES notation for 2-octyloxiran-2-amine?
The canonical SMILES for 2-octyloxiran-2-amine is CCCCCCCCC1(N)CO1.
What is the InChIKey of 2-octyloxiran-2-amine?
The InChIKey is GBOIKRZSODTIRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NO/c1-2-3-4-5-6-7-8-10(11)9-12-10/h2-9,11H2,1H3.
What are the key properties of 2-octyloxiran-2-amine?
2-octyloxiran-2-amine has a molecular weight of 171.28 g/mol, XLogP of 2.42, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-octyloxiran-2-amine is sourced from PubChem (CID 87096100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).