About 2-fluoro-2-hexyloxirane
2-fluoro-2-hexyloxirane (PubChem CID 21452195) has the molecular formula C8H15FO
and a molecular weight of 146.20 g/mol. Its IUPAC name is 2-fluoro-2-hexyloxirane.
Molecular Properties
| Compound Name | 2-fluoro-2-hexyloxirane |
| PubChem CID | 21452195 |
| Molecular Formula | C8H15FO |
| Molecular Weight | 146.20 g/mol |
| Exact Mass | 146.11 |
| IUPAC Name | 2-fluoro-2-hexyloxirane |
| SMILES | CCCCCCC1(F)CO1 |
| InChI | InChI=1S/C8H15FO/c1-2-3-4-5-6-8(9)7-10-8/h2-7H2,1H3 |
| InChIKey | PUHQXEXVMWQNRH-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.20 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-2-hexyloxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-2-hexyloxirane?
The IUPAC name of 2-fluoro-2-hexyloxirane (CID 21452195) is 2-fluoro-2-hexyloxirane.
What is the SMILES notation for 2-fluoro-2-hexyloxirane?
The canonical SMILES for 2-fluoro-2-hexyloxirane is CCCCCCC1(F)CO1.
What is the InChIKey of 2-fluoro-2-hexyloxirane?
The InChIKey is PUHQXEXVMWQNRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15FO/c1-2-3-4-5-6-8(9)7-10-8/h2-7H2,1H3.
What are the key properties of 2-fluoro-2-hexyloxirane?
2-fluoro-2-hexyloxirane has a molecular weight of 146.20 g/mol, XLogP of 2.65, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-2-hexyloxirane is sourced from PubChem (CID 21452195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).