About [[4-(2-phenylethynyl)benzoyl]amino] piperidine-4-carboxylate
[[4-(2-phenylethynyl)benzoyl]amino] piperidine-4-carboxylate (PubChem CID 87103068) has the molecular formula C21H20N2O3
and a molecular weight of 348.40 g/mol. Its IUPAC name is [[4-(2-phenylethynyl)benzoyl]amino] piperidine-4-carboxylate.
Molecular Properties
| Compound Name | [[4-(2-phenylethynyl)benzoyl]amino] piperidine-4-carboxylate |
| PubChem CID | 87103068 |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | [[4-(2-phenylethynyl)benzoyl]amino] piperidine-4-carboxylate |
| SMILES | O=C(NOC(=O)C1CCNCC1)c1ccc(C#Cc2ccccc2)cc1 |
| InChI | InChI=1S/C21H20N2O3/c24-20(23-26-21(25)19-12-14-22-15-13-19)18-10-8-17(9-11-18)7-6-16-4-2-1-3-5-16/h1-5,8-11,19,22H,12-15H2,(H,23,24) |
| InChIKey | LUWNPBAXHFVXET-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [[4-(2-phenylethynyl)benzoyl]amino] piperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[4-(2-phenylethynyl)benzoyl]amino] piperidine-4-carboxylate?
The IUPAC name of [[4-(2-phenylethynyl)benzoyl]amino] piperidine-4-carboxylate (CID 87103068) is [[4-(2-phenylethynyl)benzoyl]amino] piperidine-4-carboxylate.
What is the SMILES notation for [[4-(2-phenylethynyl)benzoyl]amino] piperidine-4-carboxylate?
The canonical SMILES for [[4-(2-phenylethynyl)benzoyl]amino] piperidine-4-carboxylate is O=C(NOC(=O)C1CCNCC1)c1ccc(C#Cc2ccccc2)cc1.
What is the InChIKey of [[4-(2-phenylethynyl)benzoyl]amino] piperidine-4-carboxylate?
The InChIKey is LUWNPBAXHFVXET-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N2O3/c24-20(23-26-21(25)19-12-14-22-15-13-19)18-10-8-17(9-11-18)7-6-16-4-2-1-3-5-16/h1-5,8-11,19,22H,12-15H2,(H,23,24).
What are the key properties of [[4-(2-phenylethynyl)benzoyl]amino] piperidine-4-carboxylate?
[[4-(2-phenylethynyl)benzoyl]amino] piperidine-4-carboxylate has a molecular weight of 348.40 g/mol, XLogP of 2.27, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [[4-(2-phenylethynyl)benzoyl]amino] piperidine-4-carboxylate is sourced from PubChem (CID 87103068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).