C20H34O16 — CID 87104973
2-ethylhexane-1,5-diol;bis(2-hydroxypropane-1,2,3-tricarboxylic acid) (PubChem CID 87104973) has the molecular formula C20H34O16 and a molecular weight of 530.48 g/mol. Its IUPAC name is 2-ethylhexane-1,5-diol;bis(2-hydroxypropane-1,2,3-tricarboxylic acid).
| Compound Name | 2-ethylhexane-1,5-diol;bis(2-hydroxypropane-1,2,3-tricarboxylic acid) |
|---|---|
| PubChem CID | 87104973 |
| Molecular Formula | C20H34O16 |
| Molecular Weight | 530.48 g/mol |
| Exact Mass | 530.18 |
| IUPAC Name | 2-ethylhexane-1,5-diol;bis(2-hydroxypropane-1,2,3-tricarboxylic acid) |
| SMILES | CCC(CO)CCC(C)O.O=C(O)CC(O)(CC(=O)O)C(=O)O.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C8H18O2.2C6H8O7/c1-3-8(6-9)5-4-7(2)10;2*7-3(8)1-6(13,5(11)12)2-4(9)10/h7-10H,3-6H2,1-2H3;2*13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | WVEOQLASDCNKTB-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 304.72 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.48 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |