About methyl-[(1R,2S)-2-methyl-1-phenyl-3-pyrrolidin-1-ylpropyl]azanide
methyl-[(1R,2S)-2-methyl-1-phenyl-3-pyrrolidin-1-ylpropyl]azanide (PubChem CID 87106535) has the molecular formula C15H23N2-
and a molecular weight of 231.36 g/mol. Its IUPAC name is methyl-[(1R,2S)-2-methyl-1-phenyl-3-pyrrolidin-1-ylpropyl]azanide.
Molecular Properties
| Compound Name | methyl-[(1R,2S)-2-methyl-1-phenyl-3-pyrrolidin-1-ylpropyl]azanide |
| PubChem CID | 87106535 |
| Molecular Formula | C15H23N2- |
| Molecular Weight | 231.36 g/mol |
| Exact Mass | 231.19 |
| IUPAC Name | methyl-[(1R,2S)-2-methyl-1-phenyl-3-pyrrolidin-1-ylpropyl]azanide |
| SMILES | C[N-][C@@H](c1ccccc1)[C@@H](C)CN1CCCC1 |
| InChI | InChI=1S/C15H23N2/c1-13(12-17-10-6-7-11-17)15(16-2)14-8-4-3-5-9-14/h3-5,8-9,13,15H,6-7,10-12H2,1-2H3/q-1/t13-,15+/m0/s1 |
| InChIKey | SEAVNIRLWKVEPJ-DZGCQCFKSA-N |
| XLogP | 3.46 |
| TPSA | 17.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.36 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze methyl-[(1R,2S)-2-methyl-1-phenyl-3-pyrrolidin-1-ylpropyl]azanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl-[(1R,2S)-2-methyl-1-phenyl-3-pyrrolidin-1-ylpropyl]azanide?
The IUPAC name of methyl-[(1R,2S)-2-methyl-1-phenyl-3-pyrrolidin-1-ylpropyl]azanide (CID 87106535) is methyl-[(1R,2S)-2-methyl-1-phenyl-3-pyrrolidin-1-ylpropyl]azanide.
What is the SMILES notation for methyl-[(1R,2S)-2-methyl-1-phenyl-3-pyrrolidin-1-ylpropyl]azanide?
The canonical SMILES for methyl-[(1R,2S)-2-methyl-1-phenyl-3-pyrrolidin-1-ylpropyl]azanide is C[N-][C@@H](c1ccccc1)[C@@H](C)CN1CCCC1.
What is the InChIKey of methyl-[(1R,2S)-2-methyl-1-phenyl-3-pyrrolidin-1-ylpropyl]azanide?
The InChIKey is SEAVNIRLWKVEPJ-DZGCQCFKSA-N. The full InChI is InChI=1S/C15H23N2/c1-13(12-17-10-6-7-11-17)15(16-2)14-8-4-3-5-9-14/h3-5,8-9,13,15H,6-7,10-12H2,1-2H3/q-1/t13-,15+/m0/s1.
What are the key properties of methyl-[(1R,2S)-2-methyl-1-phenyl-3-pyrrolidin-1-ylpropyl]azanide?
methyl-[(1R,2S)-2-methyl-1-phenyl-3-pyrrolidin-1-ylpropyl]azanide has a molecular weight of 231.36 g/mol, XLogP of 3.46, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methyl-[(1R,2S)-2-methyl-1-phenyl-3-pyrrolidin-1-ylpropyl]azanide is sourced from PubChem (CID 87106535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).