C21H27LiN2 — CID 132604880
lithium 1-phenylethyl-(1-phenyl-2-piperidin-1-ylethyl)azanide (PubChem CID 132604880) has the molecular formula C21H27LiN2 and a molecular weight of 314.40 g/mol. Its IUPAC name is lithium 1-phenylethyl-(1-phenyl-2-piperidin-1-ylethyl)azanide.
| Compound Name | lithium 1-phenylethyl-(1-phenyl-2-piperidin-1-ylethyl)azanide |
|---|---|
| PubChem CID | 132604880 |
| Molecular Formula | C21H27LiN2 |
| Molecular Weight | 314.40 g/mol |
| Exact Mass | 314.23 |
| IUPAC Name | lithium 1-phenylethyl-(1-phenyl-2-piperidin-1-ylethyl)azanide |
| SMILES | CC([N-]C(CN1CCCCC1)c1ccccc1)c1ccccc1.[Li+] |
| InChI | InChI=1S/C21H27N2.Li/c1-18(19-11-5-2-6-12-19)22-21(20-13-7-3-8-14-20)17-23-15-9-4-10-16-23;/h2-3,5-8,11-14,18,21H,4,9-10,15-17H2,1H3;/q-1;+1 |
| InChIKey | JAJQVSDBMYPFKD-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 17.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.40 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |