About dilithium;bis[(1R)-1-phenylethyl]azanide;bromide
dilithium;bis[(1R)-1-phenylethyl]azanide;bromide (PubChem CID 135082056) has the molecular formula C16H18BrLi2N
and a molecular weight of 318.11 g/mol. Its IUPAC name is dilithium;bis[(1R)-1-phenylethyl]azanide;bromide.
Molecular Properties
| Compound Name | dilithium;bis[(1R)-1-phenylethyl]azanide;bromide |
| PubChem CID | 135082056 |
| Molecular Formula | C16H18BrLi2N |
| Molecular Weight | 318.11 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | dilithium;bis[(1R)-1-phenylethyl]azanide;bromide |
| SMILES | C[C@@H]([N-][C@H](C)c1ccccc1)c1ccccc1.[Br-].[Li+].[Li+] |
| InChI | InChI=1S/C16H18N.BrH.2Li/c1-13(15-9-5-3-6-10-15)17-14(2)16-11-7-4-8-12-16;;;/h3-14H,1-2H3;1H;;/q-1;;2*+1/p-1/t13-,14-;;;/m1.../s1 |
| InChIKey | WGZHJEYFECVGGZ-IDHVVMMVSA-M |
| XLogP | -4.11 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.11 |
| LogP ≤ 5 | -4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze dilithium;bis[(1R)-1-phenylethyl]azanide;bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dilithium;bis[(1R)-1-phenylethyl]azanide;bromide?
The IUPAC name of dilithium;bis[(1R)-1-phenylethyl]azanide;bromide (CID 135082056) is dilithium;bis[(1R)-1-phenylethyl]azanide;bromide.
What is the SMILES notation for dilithium;bis[(1R)-1-phenylethyl]azanide;bromide?
The canonical SMILES for dilithium;bis[(1R)-1-phenylethyl]azanide;bromide is C[C@@H]([N-][C@H](C)c1ccccc1)c1ccccc1.[Br-].[Li+].[Li+].
What is the InChIKey of dilithium;bis[(1R)-1-phenylethyl]azanide;bromide?
The InChIKey is WGZHJEYFECVGGZ-IDHVVMMVSA-M. The full InChI is InChI=1S/C16H18N.BrH.2Li/c1-13(15-9-5-3-6-10-15)17-14(2)16-11-7-4-8-12-16;;;/h3-14H,1-2H3;1H;;/q-1;;2*+1/p-1/t13-,14-;;;/m1.../s1.
What are the key properties of dilithium;bis[(1R)-1-phenylethyl]azanide;bromide?
dilithium;bis[(1R)-1-phenylethyl]azanide;bromide has a molecular weight of 318.11 g/mol, XLogP of -4.11, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dilithium;bis[(1R)-1-phenylethyl]azanide;bromide is sourced from PubChem (CID 135082056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).