C15H26N2 — CID 87106541
[(1R,2S)-3-(tert-butylamino)-2-methyl-1-phenylpropyl]-methanidylazanium (PubChem CID 87106541) has the molecular formula C15H26N2 and a molecular weight of 234.39 g/mol. Its IUPAC name is [(1R,2S)-3-(tert-butylamino)-2-methyl-1-phenylpropyl]-methanidylazanium.
| Compound Name | [(1R,2S)-3-(tert-butylamino)-2-methyl-1-phenylpropyl]-methanidylazanium |
|---|---|
| PubChem CID | 87106541 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | [(1R,2S)-3-(tert-butylamino)-2-methyl-1-phenylpropyl]-methanidylazanium |
| SMILES | [CH2-][NH2+][C@@H](c1ccccc1)[C@@H](C)CNC(C)(C)C |
| InChI | InChI=1S/C15H26N2/c1-12(11-17-15(2,3)4)14(16-5)13-9-7-6-8-10-13/h6-10,12,14,17H,5,11,16H2,1-4H3/t12-,14+/m0/s1 |
| InChIKey | RDHNLFYMUCAXJC-GXTWGEPZSA-N |
| XLogP | 2.11 |
| TPSA | 28.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|