C15H26N2 — CID 87106757
[(1R,2S)-3-(diethylamino)-2-methyl-1-phenylpropyl]-methanidylazanium (PubChem CID 87106757) has the molecular formula C15H26N2 and a molecular weight of 234.39 g/mol. Its IUPAC name is [(1R,2S)-3-(diethylamino)-2-methyl-1-phenylpropyl]-methanidylazanium.
| Compound Name | [(1R,2S)-3-(diethylamino)-2-methyl-1-phenylpropyl]-methanidylazanium |
|---|---|
| PubChem CID | 87106757 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | [(1R,2S)-3-(diethylamino)-2-methyl-1-phenylpropyl]-methanidylazanium |
| SMILES | [CH2-][NH2+][C@@H](c1ccccc1)[C@@H](C)CN(CC)CC |
| InChI | InChI=1S/C15H26N2/c1-5-17(6-2)12-13(3)15(16-4)14-10-8-7-9-11-14/h7-11,13,15H,4-6,12,16H2,1-3H3/t13-,15+/m0/s1 |
| InChIKey | UITSBEMVNRYJCT-DZGCQCFKSA-N |
| XLogP | 2.06 |
| TPSA | 19.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|