C15H26N2O — CID 87107021
[(1R,2S)-3-[(1-hydroxy-2-methylpropan-2-yl)amino]-2-methyl-1-phenylpropyl]-methanidylazanium (PubChem CID 87107021) has the molecular formula C15H26N2O and a molecular weight of 250.39 g/mol. Its IUPAC name is [(1R,2S)-3-[(1-hydroxy-2-methylpropan-2-yl)amino]-2-methyl-1-phenylpropyl]-methanidylazanium.
| Compound Name | [(1R,2S)-3-[(1-hydroxy-2-methylpropan-2-yl)amino]-2-methyl-1-phenylpropyl]-methanidylazanium |
|---|---|
| PubChem CID | 87107021 |
| Molecular Formula | C15H26N2O |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.20 |
| IUPAC Name | [(1R,2S)-3-[(1-hydroxy-2-methylpropan-2-yl)amino]-2-methyl-1-phenylpropyl]-methanidylazanium |
| SMILES | [CH2-][NH2+][C@@H](c1ccccc1)[C@@H](C)CNC(C)(C)CO |
| InChI | InChI=1S/C15H26N2O/c1-12(10-17-15(2,3)11-18)14(16-4)13-8-6-5-7-9-13/h5-9,12,14,17-18H,4,10-11,16H2,1-3H3/t12-,14+/m0/s1 |
| InChIKey | PGLVXNBBJFQCOR-GXTWGEPZSA-N |
| XLogP | 1.08 |
| TPSA | 48.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|