C21H42O5 — CID 87107151
2,3-dihydroxypropyl 2-decoxyoctanoate (PubChem CID 87107151) has the molecular formula C21H42O5 and a molecular weight of 374.56 g/mol. Its IUPAC name is 2,3-dihydroxypropyl 2-decoxyoctanoate.
| Compound Name | 2,3-dihydroxypropyl 2-decoxyoctanoate |
|---|---|
| PubChem CID | 87107151 |
| Molecular Formula | C21H42O5 |
| Molecular Weight | 374.56 g/mol |
| Exact Mass | 374.30 |
| IUPAC Name | 2,3-dihydroxypropyl 2-decoxyoctanoate |
| SMILES | CCCCCCCCCCOC(CCCCCC)C(=O)OCC(O)CO |
| InChI | InChI=1S/C21H42O5/c1-3-5-7-9-10-11-12-14-16-25-20(15-13-8-6-4-2)21(24)26-18-19(23)17-22/h19-20,22-23H,3-18H2,1-2H3 |
| InChIKey | OHAMWYNVGFYHQZ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.56 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|