C19H26O5 — CID 87107862
(2R)-2-[(1E,3S,6R,7Z,9Z,11E)-3,6,13-trihydroxy-3-methyltrideca-1,7,9,11-tetraenyl]-2,3-dihydropyran-6-one (PubChem CID 87107862) has the molecular formula C19H26O5 and a molecular weight of 334.41 g/mol. Its IUPAC name is (2R)-2-[(1E,3S,6R,7Z,9Z,11E)-3,6,13-trihydroxy-3-methyltrideca-1,7,9,11-tetraenyl]-2,3-dihydropyran-6-one.
| Compound Name | (2R)-2-[(1E,3S,6R,7Z,9Z,11E)-3,6,13-trihydroxy-3-methyltrideca-1,7,9,11-tetraenyl]-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 87107862 |
| Molecular Formula | C19H26O5 |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | (2R)-2-[(1E,3S,6R,7Z,9Z,11E)-3,6,13-trihydroxy-3-methyltrideca-1,7,9,11-tetraenyl]-2,3-dihydropyran-6-one |
| SMILES | C[C@@](O)(/C=C/[C@H]1CC=CC(=O)O1)CC[C@@H](O)/C=C\C=C/C=C/CO |
| InChI | InChI=1S/C19H26O5/c1-19(23,14-12-17-9-7-10-18(22)24-17)13-11-16(21)8-5-3-2-4-6-15-20/h2-8,10,12,14,16-17,20-21,23H,9,11,13,15H2,1H3/b3-2-,6-4+,8-5-,14-12+/t16-,17+,19-/m0/s1 |
| InChIKey | CZZSRDTWHDVUHV-LIYVUJCRSA-N |
| XLogP | 1.97 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|