C17H19ClN5O2S+ — CID 8711058
[2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl]-propyl-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl]azanium (PubChem CID 8711058) has the molecular formula C17H19ClN5O2S+ and a molecular weight of 392.89 g/mol. Its IUPAC name is [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl]-propyl-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl]azanium.
| Compound Name | [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl]-propyl-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl]azanium |
|---|---|
| PubChem CID | 8711058 |
| Molecular Formula | C17H19ClN5O2S+ |
| Molecular Weight | 392.89 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl]-propyl-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl]azanium |
| SMILES | CCC[NH+](CC(=O)Nc1cccnc1Cl)Cc1nnc(-c2cccs2)o1 |
| InChI | InChI=1S/C17H18ClN5O2S/c1-2-8-23(10-14(24)20-12-5-3-7-19-16(12)18)11-15-21-22-17(25-15)13-6-4-9-26-13/h3-7,9H,2,8,10-11H2,1H3,(H,20,24)/p+1 |
| InChIKey | KSFIZPPDEPIJEJ-UHFFFAOYSA-O |
| XLogP | 2.28 |
| TPSA | 85.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.89 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|