C18H20N5O4S+ — CID 9374925
[2-(2-nitroanilino)-2-oxoethyl]-propyl-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl]azanium (PubChem CID 9374925) has the molecular formula C18H20N5O4S+ and a molecular weight of 402.46 g/mol. Its IUPAC name is [2-(2-nitroanilino)-2-oxoethyl]-propyl-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl]azanium.
| Compound Name | [2-(2-nitroanilino)-2-oxoethyl]-propyl-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl]azanium |
|---|---|
| PubChem CID | 9374925 |
| Molecular Formula | C18H20N5O4S+ |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | [2-(2-nitroanilino)-2-oxoethyl]-propyl-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl]azanium |
| SMILES | CCC[NH+](CC(=O)Nc1ccccc1[N+](=O)[O-])Cc1nnc(-c2cccs2)o1 |
| InChI | InChI=1S/C18H19N5O4S/c1-2-9-22(12-17-20-21-18(27-17)15-8-5-10-28-15)11-16(24)19-13-6-3-4-7-14(13)23(25)26/h3-8,10H,2,9,11-12H2,1H3,(H,19,24)/p+1 |
| InChIKey | UCRVQVXQZSIOJS-UHFFFAOYSA-O |
| XLogP | 2.14 |
| TPSA | 115.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|