C19H22N5O5+ — CID 9370920
[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]methyl-[(2S)-1-(2-nitroanilino)-1-oxopropan-2-yl]-propylazanium (PubChem CID 9370920) has the molecular formula C19H22N5O5+ and a molecular weight of 400.42 g/mol. Its IUPAC name is [5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]methyl-[(2S)-1-(2-nitroanilino)-1-oxopropan-2-yl]-propylazanium.
| Compound Name | [5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]methyl-[(2S)-1-(2-nitroanilino)-1-oxopropan-2-yl]-propylazanium |
|---|---|
| PubChem CID | 9370920 |
| Molecular Formula | C19H22N5O5+ |
| Molecular Weight | 400.42 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | [5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]methyl-[(2S)-1-(2-nitroanilino)-1-oxopropan-2-yl]-propylazanium |
| SMILES | CCC[NH+](Cc1nnc(-c2ccco2)o1)[C@@H](C)C(=O)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H21N5O5/c1-3-10-23(12-17-21-22-19(29-17)16-9-6-11-28-16)13(2)18(25)20-14-7-4-5-8-15(14)24(26)27/h4-9,11,13H,3,10,12H2,1-2H3,(H,20,25)/p+1/t13-/m0/s1 |
| InChIKey | XPFDLFCZRBCYDJ-ZDUSSCGKSA-O |
| XLogP | 2.06 |
| TPSA | 128.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.42 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|