C22H27N4O2S+ — CID 9375001
[2-oxo-2-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]ethyl]-propyl-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl]azanium (PubChem CID 9375001) has the molecular formula C22H27N4O2S+ and a molecular weight of 411.55 g/mol. Its IUPAC name is [2-oxo-2-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]ethyl]-propyl-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl]azanium.
| Compound Name | [2-oxo-2-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]ethyl]-propyl-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl]azanium |
|---|---|
| PubChem CID | 9375001 |
| Molecular Formula | C22H27N4O2S+ |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | [2-oxo-2-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]ethyl]-propyl-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl]azanium |
| SMILES | CCC[NH+](CC(=O)N[C@H]1CCCc2ccccc21)Cc1nnc(-c2cccs2)o1 |
| InChI | InChI=1S/C22H26N4O2S/c1-2-12-26(15-21-24-25-22(28-21)19-11-6-13-29-19)14-20(27)23-18-10-5-8-16-7-3-4-9-17(16)18/h3-4,6-7,9,11,13,18H,2,5,8,10,12,14-15H2,1H3,(H,23,27)/p+1/t18-/m0/s1 |
| InChIKey | DZQXUTWJLRBXTK-SFHVURJKSA-O |
| XLogP | 2.79 |
| TPSA | 72.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |