C43H82NO5+ — CID 87112354
3,3-bis[[(Z)-octadec-9-enoyl]oxy]pentan-2-yl-hydroxy-dimethylazanium (PubChem CID 87112354) has the molecular formula C43H82NO5+ and a molecular weight of 693.13 g/mol. Its IUPAC name is 3,3-bis[[(Z)-octadec-9-enoyl]oxy]pentan-2-yl-hydroxy-dimethylazanium.
| Compound Name | 3,3-bis[[(Z)-octadec-9-enoyl]oxy]pentan-2-yl-hydroxy-dimethylazanium |
|---|---|
| PubChem CID | 87112354 |
| Molecular Formula | C43H82NO5+ |
| Molecular Weight | 693.13 g/mol |
| Exact Mass | 692.62 |
| IUPAC Name | 3,3-bis[[(Z)-octadec-9-enoyl]oxy]pentan-2-yl-hydroxy-dimethylazanium |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC(CC)(OC(=O)CCCCCCC/C=C\CCCCCCCC)C(C)[N+](C)(C)O |
| InChI | InChI=1S/C43H82NO5/c1-7-10-12-14-16-18-20-22-24-26-28-30-32-34-36-38-41(45)48-43(9-3,40(4)44(5,6)47)49-42(46)39-37-35-33-31-29-27-25-23-21-19-17-15-13-11-8-2/h22-25,40,47H,7-21,26-39H2,1-6H3/q+1/b24-22-,25-23- |
| InChIKey | RBHIQDCSSFPBIZ-HKOLQMFGSA-N |
| XLogP | 13.11 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.13 |
| LogP ≤ 5 | 13.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|