C24H37N2O8P — CID 87114113
tert-butyl 3-[4-dimethoxyphosphoryl-3-oxo-2-(phenylmethoxycarbonylamino)butyl]piperidine-1-carboxylate (PubChem CID 87114113) has the molecular formula C24H37N2O8P and a molecular weight of 512.54 g/mol. Its IUPAC name is tert-butyl 3-[4-dimethoxyphosphoryl-3-oxo-2-(phenylmethoxycarbonylamino)butyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[4-dimethoxyphosphoryl-3-oxo-2-(phenylmethoxycarbonylamino)butyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 87114113 |
| Molecular Formula | C24H37N2O8P |
| Molecular Weight | 512.54 g/mol |
| Exact Mass | 512.23 |
| IUPAC Name | tert-butyl 3-[4-dimethoxyphosphoryl-3-oxo-2-(phenylmethoxycarbonylamino)butyl]piperidine-1-carboxylate |
| SMILES | COP(=O)(CC(=O)C(CC1CCCN(C(=O)OC(C)(C)C)C1)NC(=O)OCc1ccccc1)OC |
| InChI | InChI=1S/C24H37N2O8P/c1-24(2,3)34-23(29)26-13-9-12-19(15-26)14-20(21(27)17-35(30,31-4)32-5)25-22(28)33-16-18-10-7-6-8-11-18/h6-8,10-11,19-20H,9,12-17H2,1-5H3,(H,25,28) |
| InChIKey | FOKLYLCELJTRMT-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 120.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.54 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|