About ethoxyethane;hexane;2-propan-2-yloxypropane
ethoxyethane;hexane;2-propan-2-yloxypropane (PubChem CID 87119579) has the molecular formula C16H38O2
and a molecular weight of 262.48 g/mol. Its IUPAC name is ethoxyethane;hexane;2-propan-2-yloxypropane.
Molecular Properties
| Compound Name | ethoxyethane;hexane;2-propan-2-yloxypropane |
| PubChem CID | 87119579 |
| Molecular Formula | C16H38O2 |
| Molecular Weight | 262.48 g/mol |
| Exact Mass | 262.29 |
| IUPAC Name | ethoxyethane;hexane;2-propan-2-yloxypropane |
| SMILES | CC(C)OC(C)C.CCCCCC.CCOCC |
| InChI | InChI=1S/C6H14O.C6H14.C4H10O/c1-5(2)7-6(3)4;1-3-5-6-4-2;1-3-5-4-2/h5-6H,1-4H3;3-6H2,1-2H3;3-4H2,1-2H3 |
| InChIKey | VISPSMUBRVHQMR-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 262.48 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethoxyethane;hexane;2-propan-2-yloxypropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethoxyethane;hexane;2-propan-2-yloxypropane?
The IUPAC name of ethoxyethane;hexane;2-propan-2-yloxypropane (CID 87119579) is ethoxyethane;hexane;2-propan-2-yloxypropane.
What is the SMILES notation for ethoxyethane;hexane;2-propan-2-yloxypropane?
The canonical SMILES for ethoxyethane;hexane;2-propan-2-yloxypropane is CC(C)OC(C)C.CCCCCC.CCOCC.
What is the InChIKey of ethoxyethane;hexane;2-propan-2-yloxypropane?
The InChIKey is VISPSMUBRVHQMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O.C6H14.C4H10O/c1-5(2)7-6(3)4;1-3-5-6-4-2;1-3-5-4-2/h5-6H,1-4H3;3-6H2,1-2H3;3-4H2,1-2H3.
What are the key properties of ethoxyethane;hexane;2-propan-2-yloxypropane?
ethoxyethane;hexane;2-propan-2-yloxypropane has a molecular weight of 262.48 g/mol, XLogP of 5.45, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethoxyethane;hexane;2-propan-2-yloxypropane is sourced from PubChem (CID 87119579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).