About 2-propan-2-yloxypropane;tetradecanoic acid
2-propan-2-yloxypropane;tetradecanoic acid (PubChem CID 172837764) has the molecular formula C20H42O3
and a molecular weight of 330.55 g/mol. Its IUPAC name is 2-propan-2-yloxypropane;tetradecanoic acid.
Molecular Properties
| Compound Name | 2-propan-2-yloxypropane;tetradecanoic acid |
| PubChem CID | 172837764 |
| Molecular Formula | C20H42O3 |
| Molecular Weight | 330.55 g/mol |
| Exact Mass | 330.31 |
| IUPAC Name | 2-propan-2-yloxypropane;tetradecanoic acid |
| SMILES | CC(C)OC(C)C.CCCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C14H28O2.C6H14O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16;1-5(2)7-6(3)4/h2-13H2,1H3,(H,15,16);5-6H,1-4H3 |
| InChIKey | WJQCKELOIUXQQR-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 330.55 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-propan-2-yloxypropane;tetradecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propan-2-yloxypropane;tetradecanoic acid?
The IUPAC name of 2-propan-2-yloxypropane;tetradecanoic acid (CID 172837764) is 2-propan-2-yloxypropane;tetradecanoic acid.
What is the SMILES notation for 2-propan-2-yloxypropane;tetradecanoic acid?
The canonical SMILES for 2-propan-2-yloxypropane;tetradecanoic acid is CC(C)OC(C)C.CCCCCCCCCCCCCC(=O)O.
What is the InChIKey of 2-propan-2-yloxypropane;tetradecanoic acid?
The InChIKey is WJQCKELOIUXQQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28O2.C6H14O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16;1-5(2)7-6(3)4/h2-13H2,1H3,(H,15,16);5-6H,1-4H3.
What are the key properties of 2-propan-2-yloxypropane;tetradecanoic acid?
2-propan-2-yloxypropane;tetradecanoic acid has a molecular weight of 330.55 g/mol, XLogP of 6.59, 14 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-yloxypropane;tetradecanoic acid is sourced from PubChem (CID 172837764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).