2-propan-2-yloxypropane;tetradecanoic acid

C20H42O3 — CID 172837764

IUPAC2-propan-2-yloxypropane;tetradecanoic acid
SMILESCC(C)OC(C)C.CCCCCCCCCCCCCC(=O)O
InChIInChI=1S/C14H28O2.C6H14O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16;1-5(2)7-6(3)4/h2-13H2,1H3,(H,15,16);5-6H,1-4H3
InChIKeyWJQCKELOIUXQQR-UHFFFAOYSA-N
MW330.55 g/mol
LogP6.59
Rot. Bonds14

About 2-propan-2-yloxypropane;tetradecanoic acid

2-propan-2-yloxypropane;tetradecanoic acid (PubChem CID 172837764) has the molecular formula C20H42O3 and a molecular weight of 330.55 g/mol. Its IUPAC name is 2-propan-2-yloxypropane;tetradecanoic acid.

Molecular Properties

Compound Name2-propan-2-yloxypropane;tetradecanoic acid
PubChem CID172837764
Molecular FormulaC20H42O3
Molecular Weight330.55 g/mol
Exact Mass330.31
IUPAC Name2-propan-2-yloxypropane;tetradecanoic acid
SMILESCC(C)OC(C)C.CCCCCCCCCCCCCC(=O)O
InChIInChI=1S/C14H28O2.C6H14O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16;1-5(2)7-6(3)4/h2-13H2,1H3,(H,15,16);5-6H,1-4H3
InChIKeyWJQCKELOIUXQQR-UHFFFAOYSA-N
XLogP6.59
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds14
Heavy Atoms23
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500330.55
LogP ≤ 56.59
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-propan-2-yloxypropane;tetradecanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-propan-2-yloxypropane;tetradecanoic acid?
The IUPAC name of 2-propan-2-yloxypropane;tetradecanoic acid (CID 172837764) is 2-propan-2-yloxypropane;tetradecanoic acid.
What is the SMILES notation for 2-propan-2-yloxypropane;tetradecanoic acid?
The canonical SMILES for 2-propan-2-yloxypropane;tetradecanoic acid is CC(C)OC(C)C.CCCCCCCCCCCCCC(=O)O.
What is the InChIKey of 2-propan-2-yloxypropane;tetradecanoic acid?
The InChIKey is WJQCKELOIUXQQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28O2.C6H14O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16;1-5(2)7-6(3)4/h2-13H2,1H3,(H,15,16);5-6H,1-4H3.
What are the key properties of 2-propan-2-yloxypropane;tetradecanoic acid?
2-propan-2-yloxypropane;tetradecanoic acid has a molecular weight of 330.55 g/mol, XLogP of 6.59, 14 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-yloxypropane;tetradecanoic acid is sourced from PubChem (CID 172837764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).