C26H21Cl2N3O2 — CID 87121239
1-[4-[4-(aminomethyl)anilino]-6-(3,5-dichloro-4-hydroxyphenyl)quinolin-3-yl]cyclopropane-1-carbaldehyde (PubChem CID 87121239) has the molecular formula C26H21Cl2N3O2 and a molecular weight of 478.38 g/mol. Its IUPAC name is 1-[4-[4-(aminomethyl)anilino]-6-(3,5-dichloro-4-hydroxyphenyl)quinolin-3-yl]cyclopropane-1-carbaldehyde.
| Compound Name | 1-[4-[4-(aminomethyl)anilino]-6-(3,5-dichloro-4-hydroxyphenyl)quinolin-3-yl]cyclopropane-1-carbaldehyde |
|---|---|
| PubChem CID | 87121239 |
| Molecular Formula | C26H21Cl2N3O2 |
| Molecular Weight | 478.38 g/mol |
| Exact Mass | 477.10 |
| IUPAC Name | 1-[4-[4-(aminomethyl)anilino]-6-(3,5-dichloro-4-hydroxyphenyl)quinolin-3-yl]cyclopropane-1-carbaldehyde |
| SMILES | NCc1ccc(Nc2c(C3(C=O)CC3)cnc3ccc(-c4cc(Cl)c(O)c(Cl)c4)cc23)cc1 |
| InChI | InChI=1S/C26H21Cl2N3O2/c27-21-10-17(11-22(28)25(21)33)16-3-6-23-19(9-16)24(20(13-30-23)26(14-32)7-8-26)31-18-4-1-15(12-29)2-5-18/h1-6,9-11,13-14,33H,7-8,12,29H2,(H,30,31) |
| InChIKey | ZRQPGJLTERNXDB-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.38 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|