C10H16F4N2O3S — CID 87122105
2-butyl-3-methyl-1H-imidazol-3-ium;1,1,2,2-tetrafluoroethanesulfonate (PubChem CID 87122105) has the molecular formula C10H16F4N2O3S and a molecular weight of 320.31 g/mol. Its IUPAC name is 2-butyl-3-methyl-1H-imidazol-3-ium;1,1,2,2-tetrafluoroethanesulfonate.
| Compound Name | 2-butyl-3-methyl-1H-imidazol-3-ium;1,1,2,2-tetrafluoroethanesulfonate |
|---|---|
| PubChem CID | 87122105 |
| Molecular Formula | C10H16F4N2O3S |
| Molecular Weight | 320.31 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 2-butyl-3-methyl-1H-imidazol-3-ium;1,1,2,2-tetrafluoroethanesulfonate |
| SMILES | CCCCc1[nH]cc[n+]1C.O=S(=O)([O-])C(F)(F)C(F)F |
| InChI | InChI=1S/C8H14N2.C2H2F4O3S/c1-3-4-5-8-9-6-7-10(8)2;3-1(4)2(5,6)10(7,8)9/h6-7H,3-5H2,1-2H3;1H,(H,7,8,9) |
| InChIKey | KYAPHOWMPRGVJC-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 76.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.31 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|