C18H23BrN2O4 — CID 87127388
tert-butyl 2-[(4-bromophenyl)-(2-oxoethyl)carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 87127388) has the molecular formula C18H23BrN2O4 and a molecular weight of 411.30 g/mol. Its IUPAC name is tert-butyl 2-[(4-bromophenyl)-(2-oxoethyl)carbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[(4-bromophenyl)-(2-oxoethyl)carbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 87127388 |
| Molecular Formula | C18H23BrN2O4 |
| Molecular Weight | 411.30 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | tert-butyl 2-[(4-bromophenyl)-(2-oxoethyl)carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC1C(=O)N(CC=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C18H23BrN2O4/c1-18(2,3)25-17(24)21-10-4-5-15(21)16(23)20(11-12-22)14-8-6-13(19)7-9-14/h6-9,12,15H,4-5,10-11H2,1-3H3 |
| InChIKey | XRLQMKXUMPDTNI-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.30 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|