C19H24Cl2N2O5 — CID 87136841
tert-butyl (3S)-N-[(2,6-dichlorophenyl)methoxy]-4-oxo-3-(prop-2-enoxycarbonylamino)butanimidate (PubChem CID 87136841) has the molecular formula C19H24Cl2N2O5 and a molecular weight of 431.32 g/mol. Its IUPAC name is tert-butyl (3S)-N-[(2,6-dichlorophenyl)methoxy]-4-oxo-3-(prop-2-enoxycarbonylamino)butanimidate.
| Compound Name | tert-butyl (3S)-N-[(2,6-dichlorophenyl)methoxy]-4-oxo-3-(prop-2-enoxycarbonylamino)butanimidate |
|---|---|
| PubChem CID | 87136841 |
| Molecular Formula | C19H24Cl2N2O5 |
| Molecular Weight | 431.32 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | tert-butyl (3S)-N-[(2,6-dichlorophenyl)methoxy]-4-oxo-3-(prop-2-enoxycarbonylamino)butanimidate |
| SMILES | C=CCOC(=O)N[C@H](C=O)CC(=NOCc1c(Cl)cccc1Cl)OC(C)(C)C |
| InChI | InChI=1S/C19H24Cl2N2O5/c1-5-9-26-18(25)22-13(11-24)10-17(28-19(2,3)4)23-27-12-14-15(20)7-6-8-16(14)21/h5-8,11,13H,1,9-10,12H2,2-4H3,(H,22,25)/t13-/m0/s1 |
| InChIKey | WXIIYAYVJPSYGJ-ZDUSSCGKSA-N |
| XLogP | 4.51 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.32 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|