About iron(2+);bis(propan-2-yloxymethanedithioate)
iron(2+);bis(propan-2-yloxymethanedithioate) (PubChem CID 87139851) has the molecular formula C8H14FeO2S4
and a molecular weight of 326.31 g/mol. Its IUPAC name is iron(2+);bis(propan-2-yloxymethanedithioate).
Molecular Properties
| Compound Name | iron(2+);bis(propan-2-yloxymethanedithioate) |
| PubChem CID | 87139851 |
| Molecular Formula | C8H14FeO2S4 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 325.92 |
| IUPAC Name | iron(2+);bis(propan-2-yloxymethanedithioate) |
| SMILES | CC(C)OC(=S)[S-].CC(C)OC(=S)[S-].[Fe+2] |
| InChI | InChI=1S/2C4H8OS2.Fe/c2*1-3(2)5-4(6)7;/h2*3H,1-2H3,(H,6,7);/q;;+2/p-2 |
| InChIKey | WDGQEUZDRGGEJA-UHFFFAOYSA-L |
| XLogP | 2.48 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze iron(2+);bis(propan-2-yloxymethanedithioate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iron(2+);bis(propan-2-yloxymethanedithioate)?
The IUPAC name of iron(2+);bis(propan-2-yloxymethanedithioate) (CID 87139851) is iron(2+);bis(propan-2-yloxymethanedithioate).
What is the SMILES notation for iron(2+);bis(propan-2-yloxymethanedithioate)?
The canonical SMILES for iron(2+);bis(propan-2-yloxymethanedithioate) is CC(C)OC(=S)[S-].CC(C)OC(=S)[S-].[Fe+2].
What is the InChIKey of iron(2+);bis(propan-2-yloxymethanedithioate)?
The InChIKey is WDGQEUZDRGGEJA-UHFFFAOYSA-L. The full InChI is InChI=1S/2C4H8OS2.Fe/c2*1-3(2)5-4(6)7;/h2*3H,1-2H3,(H,6,7);/q;;+2/p-2.
What are the key properties of iron(2+);bis(propan-2-yloxymethanedithioate)?
iron(2+);bis(propan-2-yloxymethanedithioate) has a molecular weight of 326.31 g/mol, XLogP of 2.48, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for iron(2+);bis(propan-2-yloxymethanedithioate) is sourced from PubChem (CID 87139851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).