About sodium;hydride;O-propan-2-yl hydroxysulfanylmethanethioate
sodium;hydride;O-propan-2-yl hydroxysulfanylmethanethioate (PubChem CID 174932410) has the molecular formula C4H9NaO2S2
and a molecular weight of 176.24 g/mol. Its IUPAC name is sodium;hydride;O-propan-2-yl hydroxysulfanylmethanethioate.
Molecular Properties
| Compound Name | sodium;hydride;O-propan-2-yl hydroxysulfanylmethanethioate |
| PubChem CID | 174932410 |
| Molecular Formula | C4H9NaO2S2 |
| Molecular Weight | 176.24 g/mol |
| Exact Mass | 175.99 |
| IUPAC Name | sodium;hydride;O-propan-2-yl hydroxysulfanylmethanethioate |
| SMILES | CC(C)OC(=S)SO.[H-].[Na+] |
| InChI | InChI=1S/C4H8O2S2.Na.H/c1-3(2)6-4(7)8-5;;/h3,5H,1-2H3;;/q;+1;-1 |
| InChIKey | FBPFXOZKEGMQDX-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.24 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;O-propan-2-yl hydroxysulfanylmethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;O-propan-2-yl hydroxysulfanylmethanethioate?
The IUPAC name of sodium;hydride;O-propan-2-yl hydroxysulfanylmethanethioate (CID 174932410) is sodium;hydride;O-propan-2-yl hydroxysulfanylmethanethioate.
What is the SMILES notation for sodium;hydride;O-propan-2-yl hydroxysulfanylmethanethioate?
The canonical SMILES for sodium;hydride;O-propan-2-yl hydroxysulfanylmethanethioate is CC(C)OC(=S)SO.[H-].[Na+].
What is the InChIKey of sodium;hydride;O-propan-2-yl hydroxysulfanylmethanethioate?
The InChIKey is FBPFXOZKEGMQDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O2S2.Na.H/c1-3(2)6-4(7)8-5;;/h3,5H,1-2H3;;/q;+1;-1.
What are the key properties of sodium;hydride;O-propan-2-yl hydroxysulfanylmethanethioate?
sodium;hydride;O-propan-2-yl hydroxysulfanylmethanethioate has a molecular weight of 176.24 g/mol, XLogP of -0.98, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;O-propan-2-yl hydroxysulfanylmethanethioate is sourced from PubChem (CID 174932410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).