C12H23O6PS2 — CID 87146600
1-O-tert-butyl 4-O-ethyl 2-dimethoxyphosphinothioylsulfanylbutanedioate (PubChem CID 87146600) has the molecular formula C12H23O6PS2 and a molecular weight of 358.42 g/mol. Its IUPAC name is 1-O-tert-butyl 4-O-ethyl 2-dimethoxyphosphinothioylsulfanylbutanedioate.
| Compound Name | 1-O-tert-butyl 4-O-ethyl 2-dimethoxyphosphinothioylsulfanylbutanedioate |
|---|---|
| PubChem CID | 87146600 |
| Molecular Formula | C12H23O6PS2 |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | 1-O-tert-butyl 4-O-ethyl 2-dimethoxyphosphinothioylsulfanylbutanedioate |
| SMILES | CCOC(=O)CC(SP(=S)(OC)OC)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H23O6PS2/c1-7-17-10(13)8-9(11(14)18-12(2,3)4)21-19(20,15-5)16-6/h9H,7-8H2,1-6H3 |
| InChIKey | AICQSZGFHIZSQB-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|